| Identification | |
| Name: | 4-Nitrobenzonitrile |
| Synonyms: | para-nitrobenzonitrile |
| CAS: | 619-72-7 |
| EINECS: | 210-610-0 |
| Molecular Formula: | C7H4N2O2 |
| Molecular Weight: | 148.11886 |
| InChI: | InChI=1S/C7H4N2O2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.31 g/cm3 |
| Stability: | No data. |
| Water Solubility: | slightly soluble in water |
| Solubility: | slightly soluble in water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?4-Nitrobenzonitrile (CAS NO.619-72-7) is also named as 4-Cyanonitrobenzene ; AI3-00478 ; Benzonitrile, 4-nitro- ; CCRIS 2328 ; NSC 5383 ; p-Cyanonitrobenzene ; p-Nitrobenzonitrile?; Benzonitrile, p-nitro-?.? 4-Nitrobenzonitrile (CAS NO.619-72-7) is?white to light yellow crystal powder. It is soluble in chloroform, acetic acid and hot ethanol, slightly soluble in water and ether. It can sublimate with water vapor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
