| Identification | |
| Name: | Propanoic acid,2-hydroxy-, (3Z)-3-hexen-1-yl ester |
| Synonyms: | Propanoicacid, 2-hydroxy-, (3Z)-3-hexenyl ester (9CI); Propanoic acid, 2-hydroxy-,3-hexenyl ester, (Z)-; (Z)-3-Hexenyl lactate |
| CAS: | 61931-81-5 |
| EINECS: | 263-337-4 |
| Molecular Formula: | C9H16 O3 |
| Molecular Weight: | 172.22154 |
| InChI: | InChI=1S/C9H16O3/c1-3-4-5-6-7-12-9(11)8(2)10/h4-5,8,10H,3,6-7H2,1-2H3/b5-4- |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.982 |
| Refractive index: | 1.446 |
| Water Solubility: | Insoluble in water; soluble in alcohol |
| Solubility: | Insoluble in water; soluble in alcohol |
| Appearance: | colorless liquid |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
