| Identification | |
| Name: | 2-Furancarboxaldehyde,5-methyl- |
| Synonyms: | 2-Furaldehyde,5-methyl- (6CI,8CI);2-Formyl-5-methylfuran;2-Formyl-5-methyltetrahydrofuran;2-Methyl-5-formylfuran;2-Methyl-5-furaldehyde;5-Methyl-2-furaldehyde;5-Methyl-2-furancarboxaldehyde;5-Methyl-2-furfural;5-Methyl-2-furfuraldehyde;5-Methyl-2-furfurylaldehyde;5-Methylfuran-2-al;5-Methylfuran-2-aldehyde;5-Methylfuran-2-carbaldehyde;5-Methylfurfural;5-Methylfurfuraldehyde; |
| CAS: | 620-02-0 |
| EINECS: | 210-622-6 |
| Molecular Formula: | C6H6O2 |
| Molecular Weight: | 110.11064 |
| InChI: | InChI=1S/C6H6O2/c1-5-2-3-6(4-7)8-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.1 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.529-1.532 |
| Water Solubility: | Colourless liquid, spicy-sweet, warm and slightly caramellic odour |
| Solubility: | Colourless liquid, spicy-sweet, warm and slightly caramellic odour |
| Appearance: | Colorless to light yellow liquid |
| Specification: | Colorless to light yellow liqui Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| HS Code: | 29329995 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Air Sensitive |
| Color: | very deep yellow to brown |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
