| Identification |
| Name: | Tribenzylamine |
| Synonyms: | - |
| CAS: | 620-40-6 |
| EINECS: | 210-638-3 |
| Molecular Formula: | C21H21N |
| Molecular Weight: | 287.4 |
| InChI: | InChI=1/C21H21N/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15H,16-18H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1325 |
| Density: | 0.991g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white to light cream powder |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
