Identification |
Name: | Heptanoic acid,1,1',1''-(1,2,3-propanetriyl) ester |
Synonyms: | Heptanoicacid, 1,2,3-propanetriyl ester (9CI); Heptanoin, tri- (6CI,7CI,8CI); DermofeelTC 7; Glycerol triheptanoate; Glyceryl triheptanoate; Trienanthoin;Triheptanoic glyceride; Triheptanoin; Trioenanthoin |
CAS: | 620-67-7 |
EINECS: | 210-647-2 |
Molecular Formula: | C24H44 O6 |
Molecular Weight: | 428.60256 |
InChI: | InChI=1S/C24H44O6/c1-4-7-10-13-16-22(25)28-19-21(30-24(27)18-15-12-9-6-3)20-29-23(26)17-14-11-8-5-2/h21H,4-20H2,1-3H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 195.5°C |
Boiling Point: | Vapour density: |
Density: | 0.966 g/mL at 20 °C(lit.) |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | n20/D 1.444 |
Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Skin irritant. Toxicity data (The meaning of any toxicological abbreviations which appear |
Solubility: | |
Appearance: | colourless liquid |
Flash Point: | 195.5°C |
Safety Data |
|
|