Identification |
Name: | Ethanediamide,N1,N2-diphenyl- |
Synonyms: | N,N'-Diphenyloxamide;N,N'-Diphenyloxalic acid diamide;N,N'-Diphenyloxalamide;NSC 4183;Oxalanilide;Ethanediamide,N,N'-diphenyl- (9CI);Oxanilide (6CI,7CI,8CI); |
CAS: | 620-81-5 |
EINECS: | 210-653-5 |
Molecular Formula: | C14H12N2O2 |
Molecular Weight: | 240.26 |
InChI: | InChI=1/C14H12N2O2/c17-13(15-11-7-3-1-4-8-11)14(18)16-12-9-5-2-6-10-12/h1-10H,(H,15,17)(H,16,18) |
Molecular Structure: |
|
Properties |
Boiling Point: | >360 |
Density: | 1.309g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.684 |
Solubility: | Insoluble |
Appearance: | White crystalline powder. |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Usage: | Uv absorber used in plastics and coatings. |
Safety Data |
|
|