| Identification | |
| Name: | Benzenamine,4-methyl-N-(4-methylphenyl)- |
| Synonyms: | 4,4'-dimethyldiphenylamine;Di-p-tolylamine(6CI,7CI,8CI);4,4'-Dimethyldiphenylamine;Bis(4-methylphenyl)amine;Bis(p-tolyl)amine;N,N-Bis(4-methylphenyl)amine;N-p-Tolyl-p-toluidine; |
| CAS: | 620-93-9 |
| EINECS: | 210-659-8 |
| Molecular Formula: | C14H15N |
| Molecular Weight: | 197.28 |
| InChI: | InChI=1/C14H15N/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10,15H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.049 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.611 |
| Solubility: | Insoluble |
| Appearance: | White Powder |
| Specification: |
?4,4-Dimethyldiphenylamine (DMDPA) , its cas register number is 620-93-9. It also can be called?Di-p-tolylamine ;?and 4-Methyl-N-(4-methylphenyl)benzenamine . |
| Storage Temperature: | Keep tightly closed. Store in a cool dry place. |
| Safety Data | |
 |
|
