Identification |
Name: | 1,3,5-Trimethoxybenzene |
Synonyms: | 1,3,5-Trimethoxybenzene/Phloroglucinol trimethyl ether; O,O,O-1,3,5-trimethylresorcinol; Phloroglucinol trimethyl ether; 1,3,5-trimethyoxy benzene |
CAS: | 621-23-8 |
EINECS: | 210-673-4 |
Molecular Formula: | C9H12O3 |
Molecular Weight: | 168.19 |
InChI: | InChI=1/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
Molecular Structure: |
|
Properties |
Transport: | 25kgs |
Density: | 1.041 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1,533 |
Water Solubility: | insoluble |
Solubility: | Insoluble |
Appearance: | white to off-white crystal |
Packinggroup: | III |
HS Code: | 29093090 |
Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|