| Identification | |
| Name: | Acetamide,N-(3-hydroxyphenyl)- |
| Synonyms: | Acetanilide,3'-hydroxy- (7CI,8CI);3-(Acetylamino)-1-hydroxybenzene;3-(Acetylamino)phenol;3-Acetamidophenol;3'-Hydroxyacetanilide;BS 479;BS 749;Metalid;N-(3-Hydroxyphenyl)acetamide;N-Acetyl-3-hydroxyaniline;N-Acetyl-m-aminophenol;NSC 3990;Pedituss;Pyrapap;Rystal;m-(Acetylamino)phenol;m-Acetamidophenol;m-Hydroxyacetanilide; |
| CAS: | 621-42-1 |
| EINECS: | 210-687-0 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-6(10)9-7-3-2-4-8(11)5-7/h2-5,11H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.249 g/cm3 |
| Refractive index: | 1.618 |
| Appearance: | off-white solid. |
| Specification: | off-white to tan or light grey crystals, Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29242995 |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
