| Identification |
| Name: | 3-(Diethylamino)-1,2-propanediol |
| Synonyms: | 3-Diethylamino propane-1,2-diol |
| CAS: | 621-56-7 |
| EINECS: | 210-693-3 |
| Molecular Formula: | C7H17NO2 |
| Molecular Weight: | 147.22 |
| InChI: | InChI=1/C7H17NO2/c1-3-8(4-2)5-7(10)6-9/h7,9-10H,3-6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2735 |
| Density: | 0.965 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4592-1.4612 |
| Water Solubility: | miscible |
| Solubility: | Miscible with water |
| Appearance: | clear light yellow liquid. |
| Packinggroup: | II |
| HS Code: | 29221980 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
