| Identification | |
| Name: | Boric acid (H3BO3),tripentyl ester |
| Synonyms: | Pentylborate (6CI,7CI); (Tri-n-pentoxy)borane; NSC 780; Triamyl borate; Tripentylborate; Tripentyl borate ((C5H11O)3B) |
| CAS: | 621-78-3 |
| EINECS: | 210-706-2 |
| Molecular Formula: | C15H33 B O3 |
| Molecular Weight: | 272.29 |
| InChI: | InChI=1/C15H33BO3/c1-4-7-10-13-17-16(18-14-11-8-5-2)19-15-12-9-6-3/h4-15H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | 180°C (dec.) |
| Flash Point: | 83°C |
| Boiling Point: | 63°C 0mm |
| Density: | 0.858g/cm3 |
| Refractive index: | 1.419 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 83°C |
| Safety Data | |
 |
|
