| Identification | |
| Name: | Cinnamamide |
| Synonyms: | 2-Propenamide, 3-phenyl-;3-Phenylpropenamide;2-Benzylideneacetamide;Cinnamic amide;3-Phenyl-2-propenamide;Ginnamic acid amide;3-Phenylacrylamide;Cinnamyl amide; |
| CAS: | 621-79-4 |
| EINECS: | 210-707-8 |
| Molecular Formula: | C9H9NO |
| Molecular Weight: | 147.17 |
| InChI: | InChI=1/C9H9NO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H2,10,11)/b7-6+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.121 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.613 |
| Appearance: | white crystal |
| Specification: |
Cinnamamide (621-79-4) is white crystals,insoluble in cold water, slightly soluble in hot water, soluble in ether and carbon disulfide. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
