| Identification | |
| Name: | Methanimidamide,N,N'-diphenyl- |
| Synonyms: | Diphenylformamidine;NSC 6789;N,N'-Diphenylformamidine;Formamidine,N,N'-diphenyl- (6CI,7CI,8CI); |
| CAS: | 622-15-1 |
| EINECS: | 210-720-9 |
| Molecular Formula: | C13H12N2 |
| Molecular Weight: | 196.25 |
| InChI: | InChI=1/C13H12N2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13/h1-11H,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.01 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.567 |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystal |
| Specification: |
N,N'-Diphenylformamidine (CAS NO.622-15-1) is also named as AI3-01807 ; Diphenylformamidine ; Formamidine, N,N'-diphenyl- ; N,N'-Diphenylformamidene ; N,N'-Diphenylmethanimidamide ; N,N'-Diphenymethanimidamide ; NSC 6789 ; Formamidine, N,N'-diphenyl- (6CI,7CI,8CI) ; Methanimidamide, N,N'-diphenyl- . N,N'-Diphenylformamidine (CAS NO.622-15-1) is white to yellowish crystals or cryst. powder. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
