| Identification | |
| Name: | Benzenemethanol,4-amino- |
| Synonyms: | Benzylalcohol, p-amino- (6CI,7CI,8CI);(4-Aminophenyl)methanol;(p-Aminophenyl)methanol;1-(p-Aminophenyl)methanol;4-(Hydroxymethyl)aniline;4-Aminobenzenemethanol;p-Aminobenzyl alcohol; |
| CAS: | 623-04-1 |
| EINECS: | 210-767-5 |
| Molecular Formula: | C7H9NO |
| Molecular Weight: | 123.15 |
| InChI: | InChI=1/C7H9NO/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5,8H2 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | Vapour density: |
| Density: | 1.166 g/cm3 |
| Stability: | Stable, but air and light sensitive. Incompatible with strong oxidizing agents, strong acids. Combustible. |
| Solubility: | slight
|
| Appearance: | white to light yellow crystalline powder |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
