| Identification |
| Name: | Furfuryl acetate |
| Synonyms: | 2-Furanmethanol acetate;2-Furylcarbinyl acetate;Furfuryl alcohol, acetate;5-17-03-00344 (Beilstein Handbook Reference);Acetic acid furfurylester;2-Acetoxymethylfuran;2-Furfuryl acetate;2-Furanmethanol, acetate;2-Furanmethyl acetate;FEMA No. 2490;Acetic acid furfuryl ester;2-furylmethyl acetate; |
| CAS: | 623-17-6 |
| EINECS: | 210-775-9 |
| Molecular Formula: | C7H8O3 |
| Molecular Weight: | 140.14 |
| InChI: | InChI=1/C7H8O3/c1-6(8)10-5-7-3-2-4-9-7/h2-4H,5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs |
| Density: | 1.11 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.462-1.464 |
| Solubility: | Insoluble |
| Appearance: | Clear to pale yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
