Identification |
Name: | Furfuryl acetate |
Synonyms: | 2-Furanmethanol acetate;2-Furylcarbinyl acetate;Furfuryl alcohol, acetate;5-17-03-00344 (Beilstein Handbook Reference);Acetic acid furfurylester;2-Acetoxymethylfuran;2-Furfuryl acetate;2-Furanmethanol, acetate;2-Furanmethyl acetate;FEMA No. 2490;Acetic acid furfuryl ester;2-furylmethyl acetate; |
CAS: | 623-17-6 |
EINECS: | 210-775-9 |
Molecular Formula: | C7H8O3 |
Molecular Weight: | 140.14 |
InChI: | InChI=1/C7H8O3/c1-6(8)10-5-7-3-2-4-9-7/h2-4H,5H2,1H3 |
Molecular Structure: |
|
Properties |
Transport: | 200kgs |
Density: | 1.11 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.462-1.464 |
Solubility: | Insoluble |
Appearance: | Clear to pale yellow liquid |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
|
|
|