| Identification | |
| Name: | Glycine ethyl ester hydrochloride |
| CAS: | 623-33-6 |
| EINECS: | 210-787-4 |
| Molecular Formula: | C4H10ClNO2 |
| Molecular Weight: | 139.58 |
| InChI: | InChI=1/C4H9NO2.ClH/c1-2-7-4(6)3-5;/h2-3,5H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | Crystalline |
| Specification: |
?Glycine ethyl ester hydrochloride , with CAS number of 623-33-6, can be called Glycineethylesterhydrochlor ; Glycocollethylesterhydrochloride ; usafdo-10 ; H-gly-oet HCl ; Glycine ethyl ester ; Glycine ethyl ester HCl ; Glycine ethyl ester hydrochloride ; Glycine-oet HCl . ?Glycine ethyl ester hydrochloride (CAS NO.623-33-6) is pesticide and pharmaceutical intermediates, also used in biochemical research. It?has been prepared by the action of absolute alcohol and hydrogen chloride on glycine;from glycyl chloride and alcohol;by the action of ammonia or hexamethylenetetramine on chloroacetic acid, and subsequent hydrolysis with alcoholic hydrochloric acid; by the action of hydrogen chloride and alcohol onmethyleneaminoacetonitrile;and by the reduction of ethyl cyanoformate or the corresponding imido ester hydrochloride. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29224995 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xi: Irritant
|
 |
|
