| Identification | |
| Name: | 2-Pentenal, 2-methyl- |
| Synonyms: | 2-Methyl-2-penten-1-al;2-Methyl-2-pentene-1-al;2-Methyl-3-ethylacrolein;NSC9464;a-Methyl-b-ethylacrolein;b-Ethyl-a-methylacrolein; |
| CAS: | 623-36-9 |
| EINECS: | 210-789-5 |
| Molecular Formula: | C6H10O |
| Molecular Weight: | 98.1430 |
| InChI: | InChI=1S/C6H10O/c1-3-4-6(2)5-7/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1989 3/PG 3 |
| Refractive index: | n20/D 1.45(lit.) |
| Appearance: | clear colorless to pale yellow liquid |
| Specification: |
2-Methyl-2-Penten-1-Al (CAS NO.623-36-9) is a clear colorless to pale yellow liquid with?a grass fragrance smells.It can soluble?in alcohol, ether, benzene and methanol, but insoluble in water.?Natural materials found in the onion in the volatile group. It?is flammable and irritating. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
