| Identification |
| Name: | Ethane,1,2-dichloro-1-ethoxy- |
| Synonyms: | Ether,1,2-dichloroethyl ethyl (6CI,7CI,8CI); 1,2-Dichloro-1-ethoxyethane;1,2-Dichloro-2-ethoxyethane; 1,2-Dichloroethyl ethyl ether; NSC 163477; a,b-Dichloroethyl ethyl ether |
| CAS: | 623-46-1 |
| EINECS: | 210-794-2 |
| Molecular Formula: | C4H8 Cl2 O |
| Molecular Weight: | 143.01 |
| InChI: | InChI=1/C4H8Cl2O/c1-2-7-4(6)3-5/h4H,2-3H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Melting Point: | -72 |
| Density: | 1.167 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.442 |
| Solubility: | 13 g/L (25 C) |
| Appearance: | Clear, very deep brown-yellow liquid. |
| Packinggroup: | I |
| Storage Temperature: | Keep tightly closed. Keep away from heat, sparks, and open flame. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
