| Identification | |
| Name: | 1,2-Propanediol,3-(dimethylamino)- |
| CAS: | 623-57-4 |
| EINECS: | 210-802-4 |
| Molecular Formula: | C5H13 N O2 |
| Molecular Weight: | 119.16222 |
| InChI: | InChI=1S/C5H13NO2/c1-6(2)3-5(8)4-7/h5,7-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3267 |
| Density: | 1.004 |
| Stability: | Stable. Incompatible with oxidizing agents, acids. |
| Refractive index: | 1.4609 |
| Water Solubility: | Miscible (soluble in alcohol) |
| Solubility: | Miscible (soluble in alcohol) |
| Appearance: | viscous clear liquid |
| Specification: | pale yellow solid Safety Statements:23-26-27-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
