| Identification | |
| Name: | trans-Ethyl crotonate |
| Synonyms: | Crotonic acid ethyl ester; trans-Methyl crotonate; 2-Butenoic acid methyl ester; Ethyl crotonate |
| CAS: | 623-70-1 |
| EINECS: | 210-808-7 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c1-3-5-6(7)8-4-2/h3,5H,4H2,1-2H3/b5-3+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1862 |
| Melting Point: | -79 |
| Density: | 0.918 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.424(lit.) |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:16-26-36/37/39-45-9-33 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 9:Keep container in a well-ventilated place 33:Take precautionary measures against static discharges |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29161980 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
