| Identification | |
| Name: | Propanoic acid,3-chloro-, ethyl ester |
| Synonyms: | Propionicacid, 3-chloro-, ethyl ester (6CI,7CI,8CI);3-Chloropropionic acid ethyl ester;Ethyl 3-chloropropanoate;Ethyl 3-chloropropionate;Ethyl b-chloropropionate;NSC 8845;ethyl-3-chloropropionate; |
| CAS: | 623-71-2 |
| EINECS: | 210-809-2 |
| Molecular Formula: | C5H9ClO2 |
| Molecular Weight: | 136.58 |
| InChI: | InChI=1/C5H9ClO2/c1-2-8-5(7)3-4-6/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Density: | 1.003 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.424-1.426 |
| Water Solubility: | Immiscible |
| Solubility: | Immiscible in water |
| Appearance: | Colorless or light yellow liquid |
| Specification: |
Propanoic acid,3-chloro-, ethyl ester , its cas register number is 623-71-2. It also can be called Ethyl 3-chloropropanoate ; Ethyl 3-chloropropionate ; Ethyl beta-chloropropionate ; Propionic acid, 3-chloro-, ethyl ester (8CI) .It is a clear colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
