| Identification | |
| Name: | 1,2-Propanediol,1,2-diacetate |
| Synonyms: | 1,2-Propanediol,diacetate (6CI,7CI,8CI,9CI);1,2-Diacetoxypropane;1,2-Propylene diacetate;1,2-Propylene glycol diacetate;Dowanol PGDA;Methylethylene acetate;Methylethylene diacetate;NSC 75843;Propylene acetate;Propylene diacetate;Propylene glycol diacetate;a-Propylene glycol diacetate; |
| CAS: | 623-84-7 |
| EINECS: | 210-817-6 |
| Molecular Formula: | C7H12O4 |
| Molecular Weight: | 160.17 |
| InChI: | InChI=1/C7H12O4/c1-5(11-7(3)9)4-10-6(2)8/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.05 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4125-1.4145 |
| Solubility: | Soluble |
| Appearance: | clear, colorless clear liquid |
| Specification: | clear colourless liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| HS Code: | 29153990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Research chemical. |
| Safety Data | |
 |
|
