| Identification | |
| Name: | Methyl pentanoate |
| Synonyms: | methyl n-valerate; methyl valerianate; Methyl valerate; n-valeric acid methyl ester |
| CAS: | 624-24-8 |
| EINECS: | 210-838-0 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.1596 |
| InChI: | InChI=1/C6H12O2/c1-3-4-5-6(7)8-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 3/PG 2 |
| Melting Point: | -91°C |
| Flash Point: | 22.2°C |
| Boiling Point: | 127.6°Cat760mmHg |
| Density: | 0.886g/cm3 |
| Refractive index: | n20/D 1.397(lit.) |
| Specification: |
Valeric Acid, Methyl Ester (CAS NO.624-24-8) is a clear colorless to yellowish oily liquid. It is highly flammable and insoluble in water. It is an ester. Esters react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides. It reacts with oxidizing agents, bases and acids. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 22.2°C |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
