| Identification |
| Name: | Benzeneacetic acid, a-phenyl-,2-[bis(1-methylethyl)amino]-1-[(dimethylamino)methyl]ethyl ester |
| Synonyms: | BRN 2169781;Benzeneacetic acid, alpha-phenyl-, 2-(bis(1-methylethyl)amino)-1-((dimethylamino)methyl)ethyl ester;AC1MIKCQ;LS-28979;[1-(dimethylamino)-3-[di(propan-2-yl)amino]propan-2-yl] 2,2-diphenylacetate;62469-42-5 |
| CAS: | 62469-42-5 |
| Molecular Formula: | C25H36 N2 O2 |
| Molecular Weight: | 396.5655 |
| InChI: | InChI=1/C25H36N2O2/c1-19(2)27(20(3)4)18-23(17-26(5)6)29-25(28)24(21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,19-20,23-24H,17-18H2,1-6H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 248.8°C |
| Boiling Point: | 487.8°C at 760 mmHg |
| Density: | 1.025g/cm3 |
| Refractive index: | 1.534 |
| Flash Point: | 248.8°C |
| Safety Data |
| |
 |