| Identification | |
| Name: | Ethylacetamide |
| Synonyms: | Acetamidoethane;N-Acetylethylamine;N-Ethylacetamide;NSC 406307; |
| CAS: | 625-50-3 |
| EINECS: | 210-896-7 |
| Molecular Formula: | C4H9NO |
| Molecular Weight: | 87.12036 |
| InChI: | InChI=1S/C4H9NO/c1-3-5-4(2)6/h3H2,1-2H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -32ºC |
| Density: | 0.924 |
| Refractive index: | 1.433 |
| Water Solubility: | Very soluble in water |
| Solubility: | Very soluble in water |
| Appearance: | water white oily liquid. |
| Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
