| Identification |
| Name: | Isopropyl formate |
| Synonyms: | Formic acid, 1-methylethyl ester; ai3-15407; formic acid, isopropyl ester; iso-Propyl formate; 1-methylethyl formate; formic acid 1-methylethyl ester; formic acid isopropyl ester; 1-Methylethyl ethanoate; Isopropylformiate; Formic acid,1-methylethyl ester |
| CAS: | 625-55-8 |
| EINECS: | 210-901-2 |
| Molecular Formula: | C4H8O2 |
| Molecular Weight: | 88.1 |
| InChI: | InChI=1/C4H8O2/c1-4(2)6-3-5/h3-4H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1281 |
| Melting Point: | -93°C |
| Flash Point: | 7? |
| Density: | 0.884 |
| Stability: | No data. |
| Refractive index: | 1.368 |
| Solubility: | Slightly soluble |
| Appearance: | Colorless liquid. Pleasant odor. |
| Packinggroup: | II |
| Flash Point: | 7? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Colorless liquid |
| Usage: | A toxic fumigant. |
| Safety Data |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
| |
 |
