| Identification | |
| Name: | 2,5-Dimethylfuran |
| Synonyms: | - |
| CAS: | 625-86-5 |
| EINECS: | 210-914-3 |
| Molecular Formula: | C6H8O |
| Molecular Weight: | 96.12712 |
| InChI: | InChI=1S/C6H8O/c1-5-3-4-6(2)7-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Flash Point: | 29 °F |
| Density: | 0.9 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.441(lit.) |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | Pale yellow to clear, colorless liquid |
| Specification: |
2,5-Dimethyl furane (CAS NO.625-86-5), its Synonyms are 2,5-Dimethylfuran ; Furan, 2,5-dimethyl- ; 2.5-Dimethyl furan . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29321900 |
| Flash Point: | 29 °F |
| Storage Temperature: | Flammables area |
| Usage: | Potential biofuel. Organic synthesis. Internal standard for nmr spectroscopy. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
