| Identification | |
| Name: | (R)-4-Bromostyrene oxide |
| Synonyms: | (2R)-2-(4-bromophenyl)oxirane; |
| CAS: | 62566-68-1 |
| Molecular Formula: | C8H7BrO |
| Molecular Weight: | 199.04 |
| InChI: | InChI=1/C8H7BrO/c9-7-3-1-6(2-4-7)8-5-10-8/h1-4,8H,5H2/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 99.3°C |
| Boiling Point: | 250.7°C at 760 mmHg |
| Density: | 1.596g/cm3 |
| Refractive index: | 1.605 |
| Specification: |
(R)-4-Bromostyrene oxide , with CAS number of 62566-68-1, can be called oxirane, 2-(4-bromophenyl)- ; 2-(4-Bromophenyl)oxirane ; 4-Bromostyrene oxide ; Oxirane, (4-bromophenyl)- (9CI) ; Oxirane, (p-bromophenyl)- . |
| Flash Point: | 99.3°C |
| Safety Data | |
 |
|
