| Identification | |
| Name: | O-Desmethyl Metoprolol |
| Synonyms: | (-4-[2-Hydroxy-3-(isopropylamino)propoxy]phenylethyl Alcohol;(-O-Demethylmetoprolol;4-[2-Hydroxy-3-[(1-methylethyl)amino]propoxy]-benzeneethanol;H 105/22;O-Desmethyl Metoprolol;SL 80-008;O-demethylmetoprolo;SL 80-0088 |
| CAS: | 62572-94-5 |
| Molecular Formula: | C14H23NO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H23NO3/c1-11(2)15-9-13(17)10-18-14-5-3-12(4-6-14)7-8-16/h3-6,11,13,15-17H,7-10H2,1-2H3 |
| Molecular Structure: | ![(C14H23NO3) (-4-[2-Hydroxy-3-(isopropylamino)propoxy]phenylethyl Alcohol;(-O-Demethylmetoprolol;4-[2-Hydroxy-3-[...](https://img.guidechem.com/structure/62572-94-5.gif) |
| Properties | |
| Melting Point: | 70-720C |
| Flash Point: | 210.6°C |
| Boiling Point: | 424.6°C at 760 mmHg |
| Density: | 1.085g/cm3 |
| Refractive index: | 1.531 |
| Specification: | Off-White Solid usageEng:A metabolite of Metoprolol |
| Flash Point: | 210.6°C |
| Usage: | A metabolite of Metoprolol |
| Safety Data | |
 |
|
