| Identification | |
| Name: | D-Arginine,hydrochloride (1:1) |
| Synonyms: | Arginine,monohydrochloride, D- (8CI); D-Arginine, monohydrochloride (9CI); D-Argininehydrochloride; NSC 46710 |
| CAS: | 627-75-8 |
| EINECS: | 211-010-1 |
| Molecular Formula: | C6H14 N4 O2 . Cl H |
| Molecular Weight: | 210.6619 |
| InChI: | InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Materials containing similar functional groups can decompose at elevated temperatures. |
| Alpha: | -21 º (C=3.5 1 N HCL) |
| Appearance: | White crystalline powder |
| Specification: | WHITE CRYSTALLINE POWDER Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store at RT. |
| Safety Data | |
 |
|
