| Identification |
| Name: | Phenol,2-(phenylmethoxy)- |
| Synonyms: | Phenol,o-(benzyloxy)- (6CI,8CI); 2-(Benzyloxy)phenol; Benzyl o-hydroxyphenyl ether;NSC 37426; NSC 72669; o-(Benzyloxy)phenol |
| CAS: | 6272-38-4 |
| EINECS: | 228-461-5 |
| Molecular Formula: | C13H12 O2 |
| Molecular Weight: | 200.24 |
| InChI: | InChI=1/C13H12O2/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-9,14H,10H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 35-40ºC |
| Boiling Point: | 335.5 ºC at 760 mmHg |
| Density: | 1.143 |
| Stability: | Decomposition will not occur if used and stored according to specifications. |
| Refractive index: | 1.591 |
| Solubility: | Insoluble |
| Appearance: | Light yellow. |
| Storage Temperature: | Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
