| Identification |
| Name: | Carbonochloridic acid,3-chloropropyl ester |
| Synonyms: | Formicacid, chloro-, 3-chloropropyl ester (8CI);(3-Chloropropoxy)carbonyl chloride;3-Chloropropyl chloroformate;g-Chloropropyl chloroformate; |
| CAS: | 628-11-5 |
| EINECS: | 425-770-9 |
| Molecular Formula: | C4H6Cl2O2 |
| Molecular Weight: | 156.99 |
| InChI: | InChI=1/C4H6Cl2O2/c5-2-1-3-8-4(6)7/h1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3277 |
| Density: | 1.302 |
| Stability: | No data. |
| Refractive index: | 1.45 |
| Solubility: | Insoluble |
| Packinggroup: | I |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
