| Identification | |
| Name: | 5-methylhexanoic acid |
| Synonyms: | - |
| CAS: | 628-46-6 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.18 |
| InChI: | InChI=1/C7H14O2/c1-6(2)4-3-5-7(8)9/h6H,3-5H2,1-2H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Flash Point: | >100°C |
| Boiling Point: | 216°C |
| Density: | 0,91 g/cm3 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Flash Point: | >100°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
