| Identification |
| Name: | Carbonochloridic acid,2-ethoxyethyl ester |
| Synonyms: | Formicacid, chloro-, 2-ethoxyethyl ester (6CI);2-Ethoxyethyl chlorocarbonate;2-Ethoxyethyl chloroformate; |
| CAS: | 628-64-8 |
| EINECS: | 211-048-9 |
| Molecular Formula: | C5H9ClO3 |
| Molecular Weight: | 152.5762 |
| InChI: | InChI=1/C5H9ClO3/c1-2-8-3-4-9-5(6)7/h2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.153 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.4169 (25 C) |
| Solubility: | Slightly soluble |
| Packinggroup: | I |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| |
 |
