| Identification | |
| Name: | Butanedioic acid,2-hydroxy-, 1,4-dibutyl ester |
| CAS: | 6280-99-5 |
| EINECS: | 228-485-6 |
| Molecular Formula: | C12H22 O5 |
| Molecular Weight: | 246.30008 |
| InChI: | InChI=1S/C12H22O5/c1-3-5-7-16-11(14)9-10(13)12(15)17-8-6-4-2/h10,13H,3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.04 |
| Water Solubility: | Stability Toxicology No toxicological data available. Toxicity data (The meaning of any toxicological abbreviations which appear in this section is given |
| Solubility: |
|
| Specification: |
dl-Dibutyl malate ,its cas register number is 6280-99-5. It also can be called Dibutyl malate ; Malic acid, dibutyl ester ;and Butanedioic acid, 2-hydroxy-, dibutyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
