| Identification | |
| Name: | (+)-Diacetyl-L-tartaric anhydride |
| Synonyms: | (3R-trans)-Dihydro-2,5-dioxofuran-3,4-diyl diacetate;(4-acetyloxy-2,5-dioxo-oxolan-3-yl) acetate;Tartaric anhydride, diacetate;O,O-Diacetyl tartaric acid anhydride;2,5-Furandione, 3, 4-bis (acetyloxy)dihydro-, (3R-trans)-;Diacetyl-L-Tartaric Anhydride;Di-O-Acetyl-L-tartaric anhydride; |
| CAS: | 6283-74-5 |
| EINECS: | 228-502-7 |
| Molecular Formula: | C8H8O7 |
| Molecular Weight: | 216.14492 |
| InChI: | InChI=1S/C8H8O7/c1-3(9)13-5-6(14-4(2)10)8(12)15-7(5)11/h5-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 130-135 °C(lit.) |
| Flash Point: | 158.2°C |
| Boiling Point: | 350.6°C at 760 mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 90 ° (C=0.5, CHCl3) |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | White crystals or needles |
| Specification: |
O,O-Diacetyl tartaric acid anhydride with CAS Registry Number of 6283-74-5 is white crystals. It is incompatible with strong oxidizing agents, strong acids. When heated to decomposition, it yields Carbon monoxide , Carbon dioxide . It is also known as (3R-trans)-Dihydro-2,5-dioxofuran-3,4-diyl diacetate . |
| Flash Point: | 158.2°C |
| Storage Temperature: | −20°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
