| Identification | |
| Name: | Methyl hydrazinocarboxylate |
| Synonyms: | Methoxycarbonylhydrazine~Methyl hydrazinocarboxylate; Methyl carbazate; methyl hydrazinecarboxylate |
| CAS: | 6294-89-9 |
| EINECS: | 228-560-3 |
| Molecular Formula: | C2H6N2O2 |
| Molecular Weight: | 90.08 |
| InChI: | InChI=1/C2H6N2O2/c1-6-2(5)4-3/h3H2,1H3,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 86.1 ºC |
| Density: | 1.161 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.434 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
Methyl carbazate (CAS NO.6294-89-9), its Synonyms are (Methoxycarbonyl)hydrazine ; Carbomethoxyhydrazide ; Hydrazinecarboxylic acid, methyl ester ; Methyl hydrazinecarboxylate ; Methyl hydrazinocarboxylate ; Methyl hydrazinoformate ; Carbazic acid, methyl ester (8CI) . It is white to pink crystalline platelets. |
| Report: |
Methyl carbazate is reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 86.1 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xi:Irritant
|
 |
|
