| Identification |
| Name: | 3-Amino-2-chloropyridine |
| Synonyms: | 2-chloro-3-pyridylamine; 3-Amino-2-Chlorpyridine; 2-Chloro-3-pyridinamine; 2-Chloro-3-aminopyridine; 3-2-chlorine pyridine acetaminophen; 2-chloro-3-pyridine amine |
| CAS: | 6298-19-7 |
| EINECS: | 228-572-9 |
| Molecular Formula: | C5H5ClN2 |
| Molecular Weight: | 128.5596 |
| InChI: | InChI=1S/C5H5ClN2/c6-5-4(7)2-1-3-8-5/h1-3H,7H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Density: | 130 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.607 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | white to yellowish crystal |
| HS Code: | 29333999 |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
