| Identification | |
| Name: | Primaquine diphosphate |
| Synonyms: | Primaquine bisphosphate; 8-(4-Amino-1-methylbutylamino)-6-methoxyquinoline diphosphate; Primaquine Phosphate |
| CAS: | 63-45-6 |
| EINECS: | 200-560-8 |
| Molecular Formula: | C15H21N3O?2(H3PO4) |
| Molecular Weight: | 455.34 |
| InChI: | InChI=1/C15H21N3O.2H3O4P/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14;2*1-5(2,3)4/h4,6,8-11,18H,3,5,7,16H2,1-2H3;2*(H3,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | moderately soluble |
| Solubility: | moderately soluble |
| Appearance: | orange powder |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Viscous liquid |
| Usage: | Antimalarial agent. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
