| Identification | |
| Name: | p-N,N-Dimethylureidoazobenzene |
| Synonyms: | p-N,N-Dimethylureidoazobenzene;Azobenzene, p-(N,N-dimethylureido)-;Urea, N,N-dimethyl-N'-(p-(phenylazo)phenyl)-;AC1MIL2Q;LS-160028;1,1-dimethyl-3-(4-phenyldiazenylphenyl)urea;63019-76-1 |
| CAS: | 63019-76-1 |
| Molecular Formula: | C15H16N4O |
| Molecular Weight: | 268.3137 |
| InChI: | InChI=1/C15H16N4O/c1-19(2)15(20)16-12-8-10-14(11-9-12)18-17-13-6-4-3-5-7-13/h3-11H,1-2H3,(H,16,20)/b18-17+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 245.2°C |
| Boiling Point: | 481.8°C at 760 mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.59 |
| Specification: |
p-N,N-Dimethylureidoazobenzene , its cas register number is 63019-76-1. It also can be called Azobenzene, p-(N,N-dimethylureido)- ; Urea, N,N-dimethyl-N'-(p-(phenylazo)phenyl)- .When heated to decomposition it emits toxic fumes of NOx. And p-N,N-Dimethylureidoazobenzene (CAS NO.63019-76-1) is a kind of qestionable carcinogen. |
| Flash Point: | 245.2°C |
| Safety Data | |
 |
|
