| Identification | |
| Name: | 1-nitropyrene |
| Synonyms: | 1-NITROPYRENE;3-Nitropyrene;Pyrene, 1-nitro-;5522-43-0;Pyrene, nitro-;NITROPYRENE;1-Nitropyrene [Nitroarenes];CCRIS 455;HSDB 6980;EINECS 226-868-2;NSC 81340;BRN 1882811;1-Nitropyrene [Polycyclic aromatic compounds];1-Nitro-pyrene;ZINC00157143;AC1L2IVS;BCR305_FLUKA;NCIOpen2_004479;N22959_ALDRICH;BIDD:ER0532;CHEMBL167395;N22959_SIGMA;MolPort-000-639-557;NSC81340;NSC-81340;SBB058388;AKOS002384330;LS-1361;NCGC00164217-01;NCGC00164217-02;LS-129450;TR-019475;N0419;TL80073752;C14421;I14-6774;I14-23155;63021-86-3 |
| CAS: | 63021-86-3 |
| Molecular Formula: | C16H9NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C16H9NO2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 155 deg C |
| Solubility: | Very soluble in diethyl ether; soluble in ethanol and benzene at 15 deg C; soluble in toluene and tetrahydrofluorenone. In water, 0.0118 mg/l @ 25 deg C |
| Color: | Yellow needles or prisms from ethanol |
| Safety Data | |
 |
|
