Identification |
Name: | 3-Bromo-5-nitrobenzoic acid |
Synonyms: | 3-Bromo-5-nitrobenzoicacid;5-Bromo-3-nitrobenzoic acid;Benzoic acid,3-bromo-5-nitro-; |
CAS: | 6307-83-1 |
Molecular Formula: | C7H4BrNO4 |
Molecular Weight: | 246.01 |
InChI: | InChI=1/C7H4BrNO4/c8-5-1-4(7(10)11)2-6(3-5)9(12)13/h1-3H,(H,10,11)/p-1 |
Molecular Structure: |
|
Properties |
Density: | 1.892 g/cm3 |
Appearance: | white to slightly yellow crystalline needles |
Specification: | white to slightly yellow crystalline needles Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|