| Identification | |
| Name: | Acetic acid,mercury(1+) salt (8CI,9CI) |
| Synonyms: | Mercuryacetate (HgOAc) (6CI); Mercurous acetate; Mercury acetate; Mercury monoacetate;Mercury(I) acetate |
| CAS: | 631-60-7 |
| EINECS: | 211-161-3 |
| Molecular Formula: | C2H4 O2 . Hg |
| Molecular Weight: | 259.63 |
| InChI: | InChI=1/C2H4O2.Hg/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1629 |
| Melting Point: | 178-180°C |
| Boiling Point: | 117.1°C at 760 mmHg |
| Density: | 3.29 |
| Specification: |
Mercury monoacetate ,its CAS NO. is 631-60-7,the synonyms is Mercurous acetate ; Acetic acid, mercury (1+) salt . |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | II |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Highly toxic by ingestion, inhalation, and skin absorption. TLV: TWA 0.1
|
 |
|
