| Identification | |
| Name: | Ethanone,1-(5-chloro-2-thienyl)- |
| Synonyms: | Ketone,5-chloro-2-thienyl methyl (6CI,7CI,8CI);1-(5-Chloro-2-thienyl)ethanone;1-(5-Chlorothiophen-2-yl)ethanone;2-Acetyl-5-chlorothiophene;2-Chloro-5-acetylthiophene;5-Chloro-2-acetylthiophene;NSC 43020; |
| CAS: | 6310-09-4 |
| EINECS: | 228-630-3 |
| Molecular Formula: | C6H5 Cl O S |
| Molecular Weight: | 160.62 |
| InChI: | InChI=1/C6H5ClOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 227 °F |
| Specification: | white to light yellow crystal powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| Flash Point: | 227 °F |
| Sensitive: | Light Sensitive |
| Safety Data | |
 |
|
