| Identification | |
| Name: | Polysiloxanes, di-Me,Me Ph |
| Synonyms: | DC 550;Siloxanes and Silicones, di-Me, Me Ph;AR 200 (silicone);DC 510;Di-Me, Me Ph silicones;Di-Me, Me Ph siloxanes;Dow Corning 510;Dow Corning550;Dow Corning Fluid 550;HR 52;KE 1843;KF 50-100;KF 50-1000;KF 50-300;KF 50-3000;OV 11;OV 3;OV 3 (siloxane);OV 61;OV 7;PPS 100;PS 061;PS 063;SH 550 (siloxane);SH 556;SH 557;SH 710;Silicones,di-Me, Me Ph;Siloxanes and Silicones, di-Me, Ph Me;TSF 433; |
| CAS: | 63148-52-7 |
| Molecular Formula: | (C7H8OSi)m.(C2H6OSi)n |
| Molecular Weight: | 408.67 |
| InChI: | InChI=1/C7H8OSi.C2H6OSi/c1-9(8)7-5-3-2-4-6-7;1-4(2)3/h2-6H,1H3;1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | <0°C |
| Flash Point: | 620 °F |
| Boiling Point: | >205°C |
| Density: | 1.102 g/mL at 25 °C(lit.) |
| Stability: | Stable. |
| Refractive index: | n20/D 1.5365(lit.) |
| Flash Point: | 620 °F |
| Safety Data | |
 |
|
