| Identification | |
| Name: | D-Threonine |
| Synonyms: | (R)-Threonine;Threonine, D-; |
| CAS: | 632-20-2 |
| EINECS: | 211-171-8 |
| Molecular Formula: | C4H9NO3 |
| Molecular Weight: | 119.12 |
| InChI: | InChI=1/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2?,3-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.307 g/cm3 |
| Alpha: | 28 o (C=6, WATER) |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | White to off white crystal |
| Specification: | white crystalline powder or crystals Safety Statements:24/25-37/39-26 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29225000 |
| Storage Temperature: | Store at RT. |
| Color: | Colorless crystals Crystals |
| Safety Data | |
 |
|
