| Identification | |
| Name: | 2,6-Dimethylbenzoic acid |
| Synonyms: | Benzoic acid, 2,6-dimethyl-; |
| CAS: | 632-46-2 |
| EINECS: | 211-177-0 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.116 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.55 |
| Solubility: | Very soluble |
| Appearance: | white to pale cream crystalline powder |
| Specification: |
2,6-Dimethylbenzoic acid , with CAS number of 632-46-2, can be called 2,6-Dimethylbenzoicacid ; benzoic acid, 2,6-dimethyl- . It is a white to pale cream crystalline powder. 2,6-Dimethylbenzoic acid (CAS NO.632-46-2) is mainly used as organic reagents and pharmaceutical intermediates. |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
