| Identification | |
| Name: | Tetrabromophthalic anhydride |
| Synonyms: | 4,5,6,7-Tetrabromo-1,3-isobenzofurandione; TBPA; Tatrabromophthalic anhydride; 1,3-Isobenzofurandione, 4,5,6,7-tetrabromo-; 1,3-Isobenzofurandione,4,5,6,7-tetrabromo-; 3,4,5,6-Tetrabromophthalic anhydride; 3,4,5,6-tetrabromophthalicanhydride; 3-Isobenzofurandione,4,5,6,7-tetrabromo-1; 4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione; 4,5,6,7-tetrabromo-3-isobenzofurandione; bromophthal |
| CAS: | 632-79-1 |
| EINECS: | 211-185-4 |
| Molecular Formula: | C8Br4O3 |
| Molecular Weight: | 463.7 |
| InChI: | InChI=1/C8Br4O3/c9-3-1-2(8(14)15-7(1)13)4(10)6(12)5(3)11 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 2.771 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.725 |
| Water Solubility: | hydrolysis |
| Solubility: | hydrolysis to acid |
| Appearance: | white to grey powder |
| HS Code: | 29173911 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Color: | NEEDLES FROM ACETIC ACID-XYLENE Pale yellow crystalline solid |
| Usage: | Flame retardant for plastics, paper, and textiles. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
