| Identification | |
| Name: | PIFITHRIN-ALPHA |
| CAS: | 63208-82-2 |
| Molecular Formula: | C16H19BrN2OS |
| Molecular Weight: | 367.3 |
| InChI: | InChI=1/C16H18N2OS/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17/h6-9,17H,2-5,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 192.1-192.5 °C(lit.) |
| Flash Point: | 230.1°C |
| Boiling Point: | 456.8°C at 760 mmHg |
| Density: | 1.28g/cm3 |
| Refractive index: | 1.666 |
| Biological Activity: | Inhibitor of p53; reversibly blocks p53-dependent transcriptional activation and apoptosis. Protects against neuronal death in models of stroke and neurodegenerative disorders. Active in vivo ; protects mice from the side-effects of cancer therapy associated with p53 induction. Potentially increases reprogramming efficiency of human somatic cells to induced pluripotent stem cells (iPSCs) by silencing p53. Also aryl hydrocarbon receptor (AHR) agonist, causes upregulation of AHR target gene CYP1A1 (EC 50 = 1.1 μ M). |
| Flash Point: | 230.1°C |
| Storage Temperature: | −20°C |
| Color: | off-white |
| Safety Data | |
 |
|
