| Identification |
| Name: | 2(1H)-Pyridinone,3-nitro- |
| Synonyms: | 2(1H)-Pyridone,3-nitro- (6CI,7CI);2-Pyridinol, 3-nitro- (8CI);2-Hydroxy-3-nitropyridine;3-Nitro-2-hydroxypyridine;3-Nitro-2-pyridinone;3-Nitro-2-pyridone;3-Nitropyridin-2(1H)-one;NSC 26281; |
| CAS: | 6332-56-5 |
| EINECS: | 228-709-2 |
| Molecular Formula: | C5H4N2O3 |
| Molecular Weight: | 140.10 |
| InChI: | InChI=1S/C5H4N2O3/c8-5-4(7(9)10)2-1-3-6-5/h1-3H,(H,6,8) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 212 oC |
| Density: | 228-709-2 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Insoluble in benzene, ether, petroleum ether and cold water, soluble in hot water, hot alcohol and dilute alkali |
| Appearance: | yellow |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Color: | yellow |
| Safety Data |
| |
 |
